C25H23N3O4S — CID 2357448
[2-(4-acetamidoanilino)-2-oxoethyl] 3-phenothiazin-10-ylpropanoate (PubChem CID 2357448) has the molecular formula C25H23N3O4S and a molecular weight of 461.54 g/mol. Its IUPAC name is [2-(4-acetamidoanilino)-2-oxoethyl] 3-phenothiazin-10-ylpropanoate.
| Compound Name | [2-(4-acetamidoanilino)-2-oxoethyl] 3-phenothiazin-10-ylpropanoate |
|---|---|
| PubChem CID | 2357448 |
| Molecular Formula | C25H23N3O4S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | [2-(4-acetamidoanilino)-2-oxoethyl] 3-phenothiazin-10-ylpropanoate |
| SMILES | CC(=O)Nc1ccc(NC(=O)COC(=O)CCN2c3ccccc3Sc3ccccc32)cc1 |
| InChI | InChI=1S/C25H23N3O4S/c1-17(29)26-18-10-12-19(13-11-18)27-24(30)16-32-25(31)14-15-28-20-6-2-4-8-22(20)33-23-9-5-3-7-21(23)28/h2-13H,14-16H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | ZYJJNYAWOPVLLA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|