C25H30N2O3S — CID 4580054
[2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 3-phenothiazin-10-ylpropanoate (PubChem CID 4580054) has the molecular formula C25H30N2O3S and a molecular weight of 438.59 g/mol. Its IUPAC name is [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 3-phenothiazin-10-ylpropanoate.
| Compound Name | [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 3-phenothiazin-10-ylpropanoate |
|---|---|
| PubChem CID | 4580054 |
| Molecular Formula | C25H30N2O3S |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 3-phenothiazin-10-ylpropanoate |
| SMILES | CC1CCCC(NC(=O)COC(=O)CCN2c3ccccc3Sc3ccccc32)C1C |
| InChI | InChI=1S/C25H30N2O3S/c1-17-8-7-9-19(18(17)2)26-24(28)16-30-25(29)14-15-27-20-10-3-5-12-22(20)31-23-13-6-4-11-21(23)27/h3-6,10-13,17-19H,7-9,14-16H2,1-2H3,(H,26,28) |
| InChIKey | XQQRZJNAYJNLCY-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|