C21H25N3O7 — CID 41071299
[2-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 41071299) has the molecular formula C21H25N3O7 and a molecular weight of 431.45 g/mol. Its IUPAC name is [2-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 41071299 |
| Molecular Formula | C21H25N3O7 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | [2-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | CC1[C@H](C)CCC[C@H]1NC(=O)COC(=O)CCN1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C21H25N3O7/c1-12-5-3-7-15(13(12)2)22-17(25)11-31-18(26)9-10-23-20(27)14-6-4-8-16(24(29)30)19(14)21(23)28/h4,6,8,12-13,15H,3,5,7,9-11H2,1-2H3,(H,22,25)/t12-,13?,15-/m1/s1 |
| InChIKey | NFYMSMHEPRLKFT-ILWWEHDPSA-N |
| XLogP | 2.07 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|