C20H13N3O8 — CID 3882456
(1,3-dioxoisoindol-2-yl)methyl 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 3882456) has the molecular formula C20H13N3O8 and a molecular weight of 423.34 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 3882456 |
| Molecular Formula | C20H13N3O8 |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | O=C(CCN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)OCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H13N3O8/c24-15(31-10-22-17(25)11-4-1-2-5-12(11)18(22)26)8-9-21-19(27)13-6-3-7-14(23(29)30)16(13)20(21)28/h1-7H,8-10H2 |
| InChIKey | DCSUKAILIVICEQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 144.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|