C19H13BrN2O7 — CID 3551788
[2-(4-bromophenyl)-2-oxoethyl] 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 3551788) has the molecular formula C19H13BrN2O7 and a molecular weight of 461.22 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 3551788 |
| Molecular Formula | C19H13BrN2O7 |
| Molecular Weight | 461.22 g/mol |
| Exact Mass | 459.99 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | O=C(CCN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)OCC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H13BrN2O7/c20-12-6-4-11(5-7-12)15(23)10-29-16(24)8-9-21-18(25)13-2-1-3-14(22(27)28)17(13)19(21)26/h1-7H,8-10H2 |
| InChIKey | SQDRNGUVXDRGKB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.22 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|