C18H10F2N2O7 — CID 7183616
[2-(3,4-difluorophenyl)-2-oxoethyl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate (PubChem CID 7183616) has the molecular formula C18H10F2N2O7 and a molecular weight of 404.28 g/mol. Its IUPAC name is [2-(3,4-difluorophenyl)-2-oxoethyl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | [2-(3,4-difluorophenyl)-2-oxoethyl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 7183616 |
| Molecular Formula | C18H10F2N2O7 |
| Molecular Weight | 404.28 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | [2-(3,4-difluorophenyl)-2-oxoethyl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate |
| SMILES | O=C(CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)OCC(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H10F2N2O7/c19-11-5-4-9(6-12(11)20)14(23)8-29-15(24)7-21-17(25)10-2-1-3-13(22(27)28)16(10)18(21)26/h1-6H,7-8H2 |
| InChIKey | BILLTUOMSJPPAR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|