C14H10F3N3O7 — CID 2488540
[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate (PubChem CID 2488540) has the molecular formula C14H10F3N3O7 and a molecular weight of 389.24 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 2488540 |
| Molecular Formula | C14H10F3N3O7 |
| Molecular Weight | 389.24 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate |
| SMILES | O=C(COC(=O)CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)NCC(F)(F)F |
| InChI | InChI=1S/C14H10F3N3O7/c15-14(16,17)6-18-9(21)5-27-10(22)4-19-12(23)7-2-1-3-8(20(25)26)11(7)13(19)24/h1-3H,4-6H2,(H,18,21) |
| InChIKey | MFFJOXRENRRCRX-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.24 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|