C12H9N3O7 — CID 3364933
(2-amino-2-oxoethyl) 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate (PubChem CID 3364933) has the molecular formula C12H9N3O7 and a molecular weight of 307.22 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | (2-amino-2-oxoethyl) 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 3364933 |
| Molecular Formula | C12H9N3O7 |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | (2-amino-2-oxoethyl) 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate |
| SMILES | NC(=O)COC(=O)CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C12H9N3O7/c13-8(16)5-22-9(17)4-14-11(18)6-2-1-3-7(15(20)21)10(6)12(14)19/h1-3H,4-5H2,(H2,13,16) |
| InChIKey | WOZHWBMLKUEARS-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 149.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|