C17H11N3O8 — CID 5033322
(3-nitrophenyl)methyl 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate (PubChem CID 5033322) has the molecular formula C17H11N3O8 and a molecular weight of 385.29 g/mol. Its IUPAC name is (3-nitrophenyl)methyl 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | (3-nitrophenyl)methyl 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 5033322 |
| Molecular Formula | C17H11N3O8 |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | (3-nitrophenyl)methyl 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate |
| SMILES | O=C(CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H11N3O8/c21-14(28-9-10-3-1-4-11(7-10)19(24)25)8-18-16(22)12-5-2-6-13(20(26)27)15(12)17(18)23/h1-7H,8-9H2 |
| InChIKey | KCXQIEDDRLHSKW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|