C17H15N3O9S — CID 55730660
[5-(dimethylsulfamoyl)furan-2-yl]methyl 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate (PubChem CID 55730660) has the molecular formula C17H15N3O9S and a molecular weight of 437.39 g/mol. Its IUPAC name is [5-(dimethylsulfamoyl)furan-2-yl]methyl 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | [5-(dimethylsulfamoyl)furan-2-yl]methyl 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 55730660 |
| Molecular Formula | C17H15N3O9S |
| Molecular Weight | 437.39 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | [5-(dimethylsulfamoyl)furan-2-yl]methyl 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate |
| SMILES | CN(C)S(=O)(=O)c1ccc(COC(=O)CN2C(=O)c3cccc([N+](=O)[O-])c3C2=O)o1 |
| InChI | InChI=1S/C17H15N3O9S/c1-18(2)30(26,27)14-7-6-10(29-14)9-28-13(21)8-19-16(22)11-4-3-5-12(20(24)25)15(11)17(19)23/h3-7H,8-9H2,1-2H3 |
| InChIKey | FAJREBNWARNTJX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 157.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.39 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|