C16H10N2O7S — CID 7183677
(2-oxo-2-thiophen-2-ylethyl) 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate (PubChem CID 7183677) has the molecular formula C16H10N2O7S and a molecular weight of 374.33 g/mol. Its IUPAC name is (2-oxo-2-thiophen-2-ylethyl) 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | (2-oxo-2-thiophen-2-ylethyl) 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 7183677 |
| Molecular Formula | C16H10N2O7S |
| Molecular Weight | 374.33 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | (2-oxo-2-thiophen-2-ylethyl) 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate |
| SMILES | O=C(CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)OCC(=O)c1cccs1 |
| InChI | InChI=1S/C16H10N2O7S/c19-11(12-5-2-6-26-12)8-25-13(20)7-17-15(21)9-3-1-4-10(18(23)24)14(9)16(17)22/h1-6H,7-8H2 |
| InChIKey | SHPFDLWHYNTJCO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|