C23H14N2O10 — CID 19646158
[4-[2-[2-(4-nitro-1,3-dioxoisoindol-2-yl)acetyl]oxyacetyl]phenyl] furan-2-carboxylate (PubChem CID 19646158) has the molecular formula C23H14N2O10 and a molecular weight of 478.37 g/mol. Its IUPAC name is [4-[2-[2-(4-nitro-1,3-dioxoisoindol-2-yl)acetyl]oxyacetyl]phenyl] furan-2-carboxylate.
| Compound Name | [4-[2-[2-(4-nitro-1,3-dioxoisoindol-2-yl)acetyl]oxyacetyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 19646158 |
| Molecular Formula | C23H14N2O10 |
| Molecular Weight | 478.37 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | [4-[2-[2-(4-nitro-1,3-dioxoisoindol-2-yl)acetyl]oxyacetyl]phenyl] furan-2-carboxylate |
| SMILES | O=C(CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)OCC(=O)c1ccc(OC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C23H14N2O10/c26-17(13-6-8-14(9-7-13)35-23(30)18-5-2-10-33-18)12-34-19(27)11-24-21(28)15-3-1-4-16(25(31)32)20(15)22(24)29/h1-10H,11-12H2 |
| InChIKey | RCTQKHQGQQAHKI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 163.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|