C24H17NO8 — CID 3989332
[4-[2-[3-(1,3-dioxoisoindol-2-yl)propanoyloxy]acetyl]phenyl] furan-2-carboxylate (PubChem CID 3989332) has the molecular formula C24H17NO8 and a molecular weight of 447.40 g/mol. Its IUPAC name is [4-[2-[3-(1,3-dioxoisoindol-2-yl)propanoyloxy]acetyl]phenyl] furan-2-carboxylate.
| Compound Name | [4-[2-[3-(1,3-dioxoisoindol-2-yl)propanoyloxy]acetyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 3989332 |
| Molecular Formula | C24H17NO8 |
| Molecular Weight | 447.40 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | [4-[2-[3-(1,3-dioxoisoindol-2-yl)propanoyloxy]acetyl]phenyl] furan-2-carboxylate |
| SMILES | O=C(CCN1C(=O)c2ccccc2C1=O)OCC(=O)c1ccc(OC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C24H17NO8/c26-19(15-7-9-16(10-8-15)33-24(30)20-6-3-13-31-20)14-32-21(27)11-12-25-22(28)17-4-1-2-5-18(17)23(25)29/h1-10,13H,11-12,14H2 |
| InChIKey | IGCZFSMXFVGTFR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 120.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|