C29H24N2O9 — CID 19646044
[4-[2-[6-(1,3-dioxoisoindol-2-yl)hexanoyloxy]acetyl]phenyl] 4-nitrobenzoate (PubChem CID 19646044) has the molecular formula C29H24N2O9 and a molecular weight of 544.52 g/mol. Its IUPAC name is [4-[2-[6-(1,3-dioxoisoindol-2-yl)hexanoyloxy]acetyl]phenyl] 4-nitrobenzoate.
| Compound Name | [4-[2-[6-(1,3-dioxoisoindol-2-yl)hexanoyloxy]acetyl]phenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 19646044 |
| Molecular Formula | C29H24N2O9 |
| Molecular Weight | 544.52 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | [4-[2-[6-(1,3-dioxoisoindol-2-yl)hexanoyloxy]acetyl]phenyl] 4-nitrobenzoate |
| SMILES | O=C(CCCCCN1C(=O)c2ccccc2C1=O)OCC(=O)c1ccc(OC(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C29H24N2O9/c32-25(19-11-15-22(16-12-19)40-29(36)20-9-13-21(14-10-20)31(37)38)18-39-26(33)8-2-1-5-17-30-27(34)23-6-3-4-7-24(23)28(30)35/h3-4,6-7,9-16H,1-2,5,8,17-18H2 |
| InChIKey | JHDABUCLOJIYQL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 150.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|