C30H26N2O9 — CID 19646108
[4-[2-[6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanoyloxy]acetyl]phenyl] 4-methylbenzoate (PubChem CID 19646108) has the molecular formula C30H26N2O9 and a molecular weight of 558.54 g/mol. Its IUPAC name is [4-[2-[6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanoyloxy]acetyl]phenyl] 4-methylbenzoate.
| Compound Name | [4-[2-[6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanoyloxy]acetyl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 19646108 |
| Molecular Formula | C30H26N2O9 |
| Molecular Weight | 558.54 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | [4-[2-[6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanoyloxy]acetyl]phenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc(C(=O)COC(=O)CCCCCN3C(=O)c4cccc([N+](=O)[O-])c4C3=O)cc2)cc1 |
| InChI | InChI=1S/C30H26N2O9/c1-19-9-11-21(12-10-19)30(37)41-22-15-13-20(14-16-22)25(33)18-40-26(34)8-3-2-4-17-31-28(35)23-6-5-7-24(32(38)39)27(23)29(31)36/h5-7,9-16H,2-4,8,17-18H2,1H3 |
| InChIKey | ANLKIZFMBGREEJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 150.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.54 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|