C22H21ClN2O6 — CID 19184367
(4-chloro-3,5-dimethylphenyl) 6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanoate (PubChem CID 19184367) has the molecular formula C22H21ClN2O6 and a molecular weight of 444.87 g/mol. Its IUPAC name is (4-chloro-3,5-dimethylphenyl) 6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanoate.
| Compound Name | (4-chloro-3,5-dimethylphenyl) 6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanoate |
|---|---|
| PubChem CID | 19184367 |
| Molecular Formula | C22H21ClN2O6 |
| Molecular Weight | 444.87 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | (4-chloro-3,5-dimethylphenyl) 6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanoate |
| SMILES | Cc1cc(OC(=O)CCCCCN2C(=O)c3cccc([N+](=O)[O-])c3C2=O)cc(C)c1Cl |
| InChI | InChI=1S/C22H21ClN2O6/c1-13-11-15(12-14(2)20(13)23)31-18(26)9-4-3-5-10-24-21(27)16-7-6-8-17(25(29)30)19(16)22(24)28/h6-8,11-12H,3-5,9-10H2,1-2H3 |
| InChIKey | VPZOVGAINMPASK-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.87 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|