C23H21N3O9 — CID 19184371
[2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanoate (PubChem CID 19184371) has the molecular formula C23H21N3O9 and a molecular weight of 483.43 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanoate.
| Compound Name | [2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanoate |
|---|---|
| PubChem CID | 19184371 |
| Molecular Formula | C23H21N3O9 |
| Molecular Weight | 483.43 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | [2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanoate |
| SMILES | COc1cc(/C=C/[N+](=O)[O-])ccc1OC(=O)CCCCCN1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C23H21N3O9/c1-34-19-14-15(11-13-25(30)31)9-10-18(19)35-20(27)8-3-2-4-12-24-22(28)16-6-5-7-17(26(32)33)21(16)23(24)29/h5-7,9-11,13-14H,2-4,8,12H2,1H3/b13-11+ |
| InChIKey | AQZJWBJZHOVHHZ-ACCUITESSA-N |
| XLogP | 3.61 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|