C27H20N2O9 — CID 20998443
[2-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]phenyl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate (PubChem CID 20998443) has the molecular formula C27H20N2O9 and a molecular weight of 516.46 g/mol. Its IUPAC name is [2-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]phenyl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | [2-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]phenyl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 20998443 |
| Molecular Formula | C27H20N2O9 |
| Molecular Weight | 516.46 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | [2-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]phenyl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate |
| SMILES | COc1ccc(/C=C/C(=O)c2ccccc2OC(=O)CN2C(=O)c3cccc([N+](=O)[O-])c3C2=O)cc1OC |
| InChI | InChI=1S/C27H20N2O9/c1-36-22-13-11-16(14-23(22)37-2)10-12-20(30)17-6-3-4-9-21(17)38-24(31)15-28-26(32)18-7-5-8-19(29(34)35)25(18)27(28)33/h3-14H,15H2,1-2H3/b12-10+ |
| InChIKey | BHIBMKMWMVUTLA-ZRDIBKRKSA-N |
| XLogP | 3.71 |
| TPSA | 142.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|