C22H16N4O8 — CID 19184602
[4-[(E)-3-amino-2-cyano-3-oxoprop-1-enyl]-2-methoxyphenyl] 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 19184602) has the molecular formula C22H16N4O8 and a molecular weight of 464.39 g/mol. Its IUPAC name is [4-[(E)-3-amino-2-cyano-3-oxoprop-1-enyl]-2-methoxyphenyl] 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [4-[(E)-3-amino-2-cyano-3-oxoprop-1-enyl]-2-methoxyphenyl] 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 19184602 |
| Molecular Formula | C22H16N4O8 |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | [4-[(E)-3-amino-2-cyano-3-oxoprop-1-enyl]-2-methoxyphenyl] 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | COc1cc(/C=C(\C#N)C(N)=O)ccc1OC(=O)CCN1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C22H16N4O8/c1-33-17-10-12(9-13(11-23)20(24)28)5-6-16(17)34-18(27)7-8-25-21(29)14-3-2-4-15(26(31)32)19(14)22(25)30/h2-6,9-10H,7-8H2,1H3,(H2,24,28)/b13-9+ |
| InChIKey | FEELFGOUVGWPGL-UKTHLTGXSA-N |
| XLogP | 1.59 |
| TPSA | 182.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|