C23H17N3O8 — CID 19197353
ethyl (E)-2-cyano-3-[3-[3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoyloxy]phenyl]prop-2-enoate (PubChem CID 19197353) has the molecular formula C23H17N3O8 and a molecular weight of 463.40 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-[3-[3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoyloxy]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-[3-[3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoyloxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 19197353 |
| Molecular Formula | C23H17N3O8 |
| Molecular Weight | 463.40 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | ethyl (E)-2-cyano-3-[3-[3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoyloxy]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/c1cccc(OC(=O)CCN2C(=O)c3cccc([N+](=O)[O-])c3C2=O)c1 |
| InChI | InChI=1S/C23H17N3O8/c1-2-33-23(30)15(13-24)11-14-5-3-6-16(12-14)34-19(27)9-10-25-21(28)17-7-4-8-18(26(31)32)20(17)22(25)29/h3-8,11-12H,2,9-10H2,1H3/b15-11+ |
| InChIKey | LXZGKAXWPLFCLI-RVDMUPIBSA-N |
| XLogP | 2.66 |
| TPSA | 156.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|