C22H22N2O6 — CID 19184345
(2-tert-butyl-4-methylphenyl) 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 19184345) has the molecular formula C22H22N2O6 and a molecular weight of 410.43 g/mol. Its IUPAC name is (2-tert-butyl-4-methylphenyl) 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | (2-tert-butyl-4-methylphenyl) 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 19184345 |
| Molecular Formula | C22H22N2O6 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | (2-tert-butyl-4-methylphenyl) 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | Cc1ccc(OC(=O)CCN2C(=O)c3cccc([N+](=O)[O-])c3C2=O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H22N2O6/c1-13-8-9-17(15(12-13)22(2,3)4)30-18(25)10-11-23-20(26)14-6-5-7-16(24(28)29)19(14)21(23)27/h5-9,12H,10-11H2,1-4H3 |
| InChIKey | GILHCEFXYOCUFF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|