About 2-(2,4-dichlorophenoxy)ethyl 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate
2-(2,4-dichlorophenoxy)ethyl 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 5241114) has the molecular formula C19H14Cl2N2O7
and a molecular weight of 453.23 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)ethyl 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate.
Molecular Properties
| Compound Name | 2-(2,4-dichlorophenoxy)ethyl 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate |
| PubChem CID | 5241114 |
| Molecular Formula | C19H14Cl2N2O7 |
| Molecular Weight | 453.23 g/mol |
| Exact Mass | 452.02 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)ethyl 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | O=C(CCN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)OCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H14Cl2N2O7/c20-11-4-5-15(13(21)10-11)29-8-9-30-16(24)6-7-22-18(25)12-2-1-3-14(23(27)28)17(12)19(22)26/h1-5,10H,6-9H2 |
| InChIKey | CMRNDBYJULHJAV-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.23 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4-dichlorophenoxy)ethyl 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dichlorophenoxy)ethyl 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate?
The IUPAC name of 2-(2,4-dichlorophenoxy)ethyl 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate (CID 5241114) is 2-(2,4-dichlorophenoxy)ethyl 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate.
What is the SMILES notation for 2-(2,4-dichlorophenoxy)ethyl 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate?
The canonical SMILES for 2-(2,4-dichlorophenoxy)ethyl 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate is O=C(CCN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)OCCOc1ccc(Cl)cc1Cl.
What is the InChIKey of 2-(2,4-dichlorophenoxy)ethyl 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate?
The InChIKey is CMRNDBYJULHJAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14Cl2N2O7/c20-11-4-5-15(13(21)10-11)29-8-9-30-16(24)6-7-22-18(25)12-2-1-3-14(23(27)28)17(12)19(22)26/h1-5,10H,6-9H2.
What are the key properties of 2-(2,4-dichlorophenoxy)ethyl 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate?
2-(2,4-dichlorophenoxy)ethyl 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate has a molecular weight of 453.23 g/mol, XLogP of 3.51, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dichlorophenoxy)ethyl 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate is sourced from PubChem (CID 5241114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).