C20H14N4O8 — CID 3100255
4-nitro-2-[4-(4-nitro-1,3-dioxoisoindol-2-yl)butyl]isoindole-1,3-dione (PubChem CID 3100255) has the molecular formula C20H14N4O8 and a molecular weight of 438.35 g/mol. Its IUPAC name is 4-nitro-2-[4-(4-nitro-1,3-dioxoisoindol-2-yl)butyl]isoindole-1,3-dione.
| Compound Name | 4-nitro-2-[4-(4-nitro-1,3-dioxoisoindol-2-yl)butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 3100255 |
| Molecular Formula | C20H14N4O8 |
| Molecular Weight | 438.35 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 4-nitro-2-[4-(4-nitro-1,3-dioxoisoindol-2-yl)butyl]isoindole-1,3-dione |
| SMILES | O=C1c2cccc([N+](=O)[O-])c2C(=O)N1CCCCN1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C20H14N4O8/c25-17-11-5-3-7-13(23(29)30)15(11)19(27)21(17)9-1-2-10-22-18(26)12-6-4-8-14(24(31)32)16(12)20(22)28/h3-8H,1-2,9-10H2 |
| InChIKey | XZBLGTCQFLHWJJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 161.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|