C20H18FN3O5 — CID 19170181
N-(3-fluorophenyl)-6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanamide (PubChem CID 19170181) has the molecular formula C20H18FN3O5 and a molecular weight of 399.38 g/mol. Its IUPAC name is N-(3-fluorophenyl)-6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanamide.
| Compound Name | N-(3-fluorophenyl)-6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanamide |
|---|---|
| PubChem CID | 19170181 |
| Molecular Formula | C20H18FN3O5 |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | N-(3-fluorophenyl)-6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanamide |
| SMILES | O=C(CCCCCN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C20H18FN3O5/c21-13-6-4-7-14(12-13)22-17(25)10-2-1-3-11-23-19(26)15-8-5-9-16(24(28)29)18(15)20(23)27/h4-9,12H,1-3,10-11H2,(H,22,25) |
| InChIKey | LIALOCJTSZZGCQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|