C25H27N3O7 — CID 19170173
butyl 3-[6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanoylamino]benzoate (PubChem CID 19170173) has the molecular formula C25H27N3O7 and a molecular weight of 481.51 g/mol. Its IUPAC name is butyl 3-[6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanoylamino]benzoate.
| Compound Name | butyl 3-[6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanoylamino]benzoate |
|---|---|
| PubChem CID | 19170173 |
| Molecular Formula | C25H27N3O7 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | butyl 3-[6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanoylamino]benzoate |
| SMILES | CCCCOC(=O)c1cccc(NC(=O)CCCCCN2C(=O)c3cccc([N+](=O)[O-])c3C2=O)c1 |
| InChI | InChI=1S/C25H27N3O7/c1-2-3-15-35-25(32)17-9-7-10-18(16-17)26-21(29)13-5-4-6-14-27-23(30)19-11-8-12-20(28(33)34)22(19)24(27)31/h7-12,16H,2-6,13-15H2,1H3,(H,26,29) |
| InChIKey | SHESGGMFJODFAT-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|