C20H18N4O7 — CID 108731973
ethyl 2-[4-(4-nitro-1,3-dioxoisoindol-2-yl)butanoylamino]pyridine-4-carboxylate (PubChem CID 108731973) has the molecular formula C20H18N4O7 and a molecular weight of 426.39 g/mol. Its IUPAC name is ethyl 2-[4-(4-nitro-1,3-dioxoisoindol-2-yl)butanoylamino]pyridine-4-carboxylate.
| Compound Name | ethyl 2-[4-(4-nitro-1,3-dioxoisoindol-2-yl)butanoylamino]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 108731973 |
| Molecular Formula | C20H18N4O7 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | ethyl 2-[4-(4-nitro-1,3-dioxoisoindol-2-yl)butanoylamino]pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1ccnc(NC(=O)CCCN2C(=O)c3cccc([N+](=O)[O-])c3C2=O)c1 |
| InChI | InChI=1S/C20H18N4O7/c1-2-31-20(28)12-8-9-21-15(11-12)22-16(25)7-4-10-23-18(26)13-5-3-6-14(24(29)30)17(13)19(23)27/h3,5-6,8-9,11H,2,4,7,10H2,1H3,(H,21,22,25) |
| InChIKey | VHAZEHJAGOZSIY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 148.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|