C16H15N5O5S — CID 19184188
6-(4-nitro-1,3-dioxoisoindol-2-yl)-N-(1,3,4-thiadiazol-2-yl)hexanamide (PubChem CID 19184188) has the molecular formula C16H15N5O5S and a molecular weight of 389.39 g/mol. Its IUPAC name is 6-(4-nitro-1,3-dioxoisoindol-2-yl)-N-(1,3,4-thiadiazol-2-yl)hexanamide.
| Compound Name | 6-(4-nitro-1,3-dioxoisoindol-2-yl)-N-(1,3,4-thiadiazol-2-yl)hexanamide |
|---|---|
| PubChem CID | 19184188 |
| Molecular Formula | C16H15N5O5S |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 6-(4-nitro-1,3-dioxoisoindol-2-yl)-N-(1,3,4-thiadiazol-2-yl)hexanamide |
| SMILES | O=C(CCCCCN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)Nc1nncs1 |
| InChI | InChI=1S/C16H15N5O5S/c22-12(18-16-19-17-9-27-16)7-2-1-3-8-20-14(23)10-5-4-6-11(21(25)26)13(10)15(20)24/h4-6,9H,1-3,7-8H2,(H,18,19,22) |
| InChIKey | MMFRVPQVAIXGSH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|