C20H17N5O5S2 — CID 108744031
6-(4-nitro-1,3-dioxoisoindol-2-yl)-N-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)hexanamide (PubChem CID 108744031) has the molecular formula C20H17N5O5S2 and a molecular weight of 471.52 g/mol. Its IUPAC name is 6-(4-nitro-1,3-dioxoisoindol-2-yl)-N-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)hexanamide.
| Compound Name | 6-(4-nitro-1,3-dioxoisoindol-2-yl)-N-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)hexanamide |
|---|---|
| PubChem CID | 108744031 |
| Molecular Formula | C20H17N5O5S2 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | 6-(4-nitro-1,3-dioxoisoindol-2-yl)-N-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)hexanamide |
| SMILES | O=C(CCCCCN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)Nc1nnc(-c2cccs2)s1 |
| InChI | InChI=1S/C20H17N5O5S2/c26-15(21-20-23-22-17(32-20)14-8-5-11-31-14)9-2-1-3-10-24-18(27)12-6-4-7-13(25(29)30)16(12)19(24)28/h4-8,11H,1-3,9-10H2,(H,21,23,26) |
| InChIKey | MVJHZUPNJHIMSS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|