C22H25N5O5S — CID 19184192
N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanamide (PubChem CID 19184192) has the molecular formula C22H25N5O5S and a molecular weight of 471.54 g/mol. Its IUPAC name is N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanamide.
| Compound Name | N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanamide |
|---|---|
| PubChem CID | 19184192 |
| Molecular Formula | C22H25N5O5S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanamide |
| SMILES | O=C(CCCCCN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)Nc1nnc(C2CCCCC2)s1 |
| InChI | InChI=1S/C22H25N5O5S/c28-17(23-22-25-24-19(33-22)14-8-3-1-4-9-14)12-5-2-6-13-26-20(29)15-10-7-11-16(27(31)32)18(15)21(26)30/h7,10-11,14H,1-6,8-9,12-13H2,(H,23,25,28) |
| InChIKey | GXCVZMYELYONNY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|