C19H20N4O3S — CID 1180198
N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-3-(1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 1180198) has the molecular formula C19H20N4O3S and a molecular weight of 384.46 g/mol. Its IUPAC name is N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-3-(1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-3-(1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 1180198 |
| Molecular Formula | C19H20N4O3S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-3-(1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | O=C(CCN1C(=O)c2ccccc2C1=O)Nc1nnc(C2CCCCC2)s1 |
| InChI | InChI=1S/C19H20N4O3S/c24-15(20-19-22-21-16(27-19)12-6-2-1-3-7-12)10-11-23-17(25)13-8-4-5-9-14(13)18(23)26/h4-5,8-9,12H,1-3,6-7,10-11H2,(H,20,22,24) |
| InChIKey | OOLUMHMBSSCZPS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|