C19H24N4O2S — CID 1402158
N'-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-N-(4-methylphenyl)butanediamide (PubChem CID 1402158) has the molecular formula C19H24N4O2S and a molecular weight of 372.49 g/mol. Its IUPAC name is N'-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-N-(4-methylphenyl)butanediamide.
| Compound Name | N'-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-N-(4-methylphenyl)butanediamide |
|---|---|
| PubChem CID | 1402158 |
| Molecular Formula | C19H24N4O2S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | N'-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-N-(4-methylphenyl)butanediamide |
| SMILES | Cc1ccc(NC(=O)CCC(=O)Nc2nnc(C3CCCCC3)s2)cc1 |
| InChI | InChI=1S/C19H24N4O2S/c1-13-7-9-15(10-8-13)20-16(24)11-12-17(25)21-19-23-22-18(26-19)14-5-3-2-4-6-14/h7-10,14H,2-6,11-12H2,1H3,(H,20,24)(H,21,23,25) |
| InChIKey | QGXRGKYEZZRLFJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |