C20H27N3O2S — CID 19191037
N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-4-(2,3-dimethylphenoxy)butanamide (PubChem CID 19191037) has the molecular formula C20H27N3O2S and a molecular weight of 373.52 g/mol. Its IUPAC name is N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-4-(2,3-dimethylphenoxy)butanamide.
| Compound Name | N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-4-(2,3-dimethylphenoxy)butanamide |
|---|---|
| PubChem CID | 19191037 |
| Molecular Formula | C20H27N3O2S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-4-(2,3-dimethylphenoxy)butanamide |
| SMILES | Cc1cccc(OCCCC(=O)Nc2nnc(C3CCCCC3)s2)c1C |
| InChI | InChI=1S/C20H27N3O2S/c1-14-8-6-11-17(15(14)2)25-13-7-12-18(24)21-20-23-22-19(26-20)16-9-4-3-5-10-16/h6,8,11,16H,3-5,7,9-10,12-13H2,1-2H3,(H,21,23,24) |
| InChIKey | RRFBAMKKHFNLJZ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|