C16H20N4OS — CID 35524324
1-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-3-(2-methylphenyl)urea (PubChem CID 35524324) has the molecular formula C16H20N4OS and a molecular weight of 316.43 g/mol. Its IUPAC name is 1-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-3-(2-methylphenyl)urea.
| Compound Name | 1-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 35524324 |
| Molecular Formula | C16H20N4OS |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 1-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-3-(2-methylphenyl)urea |
| SMILES | Cc1ccccc1NC(=O)Nc1nnc(C2CCCCC2)s1 |
| InChI | InChI=1S/C16H20N4OS/c1-11-7-5-6-10-13(11)17-15(21)18-16-20-19-14(22-16)12-8-3-2-4-9-12/h5-7,10,12H,2-4,8-9H2,1H3,(H2,17,18,20,21) |
| InChIKey | GSDJFOBHNIJGRI-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |