C21H28N4OS — CID 46952064
N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-2-phenyl-2-piperidin-1-ylacetamide (PubChem CID 46952064) has the molecular formula C21H28N4OS and a molecular weight of 384.55 g/mol. Its IUPAC name is N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-2-phenyl-2-piperidin-1-ylacetamide.
| Compound Name | N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-2-phenyl-2-piperidin-1-ylacetamide |
|---|---|
| PubChem CID | 46952064 |
| Molecular Formula | C21H28N4OS |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-2-phenyl-2-piperidin-1-ylacetamide |
| SMILES | O=C(Nc1nnc(C2CCCCC2)s1)C(c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C21H28N4OS/c26-19(22-21-24-23-20(27-21)17-12-6-2-7-13-17)18(16-10-4-1-5-11-16)25-14-8-3-9-15-25/h1,4-5,10-11,17-18H,2-3,6-9,12-15H2,(H,22,24,26) |
| InChIKey | UNLCEMSVVSBTAS-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |