C25H24N6O4S2 — CID 90186082
(2R)-2-hydroxy-N-[5-[(1S,3S)-3-[5-[[(2R)-2-hydroxy-2-phenylacetyl]amino]-1,3,4-thiadiazol-2-yl]cyclopentyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide (PubChem CID 90186082) has the molecular formula C25H24N6O4S2 and a molecular weight of 536.64 g/mol. Its IUPAC name is (2R)-2-hydroxy-N-[5-[(1S,3S)-3-[5-[[(2R)-2-hydroxy-2-phenylacetyl]amino]-1,3,4-thiadiazol-2-yl]cyclopentyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide.
| Compound Name | (2R)-2-hydroxy-N-[5-[(1S,3S)-3-[5-[[(2R)-2-hydroxy-2-phenylacetyl]amino]-1,3,4-thiadiazol-2-yl]cyclopentyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 90186082 |
| Molecular Formula | C25H24N6O4S2 |
| Molecular Weight | 536.64 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | (2R)-2-hydroxy-N-[5-[(1S,3S)-3-[5-[[(2R)-2-hydroxy-2-phenylacetyl]amino]-1,3,4-thiadiazol-2-yl]cyclopentyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide |
| SMILES | O=C(Nc1nnc([C@H]2CC[C@H](c3nnc(NC(=O)[C@H](O)c4ccccc4)s3)C2)s1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C25H24N6O4S2/c32-18(14-7-3-1-4-8-14)20(34)26-24-30-28-22(36-24)16-11-12-17(13-16)23-29-31-25(37-23)27-21(35)19(33)15-9-5-2-6-10-15/h1-10,16-19,32-33H,11-13H2,(H,26,30,34)(H,27,31,35)/t16-,17-,18+,19+/m0/s1 |
| InChIKey | ARAYZDHPHKAXGX-INDMIFKZSA-N |
| XLogP | 3.79 |
| TPSA | 150.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.64 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |