C26H28N8O2S2 — CID 90163237
2-(2-aminophenyl)-N-[5-[(1R,3R)-3-[5-[[2-(2-aminophenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 90163237) has the molecular formula C26H28N8O2S2 and a molecular weight of 548.70 g/mol. Its IUPAC name is 2-(2-aminophenyl)-N-[5-[(1R,3R)-3-[5-[[2-(2-aminophenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(2-aminophenyl)-N-[5-[(1R,3R)-3-[5-[[2-(2-aminophenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 90163237 |
| Molecular Formula | C26H28N8O2S2 |
| Molecular Weight | 548.70 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | 2-(2-aminophenyl)-N-[5-[(1R,3R)-3-[5-[[2-(2-aminophenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | Nc1ccccc1CC(=O)Nc1nnc([C@@H]2CCC[C@@H](c3nnc(NC(=O)Cc4ccccc4N)s3)C2)s1 |
| InChI | InChI=1S/C26H28N8O2S2/c27-19-10-3-1-6-15(19)13-21(35)29-25-33-31-23(37-25)17-8-5-9-18(12-17)24-32-34-26(38-24)30-22(36)14-16-7-2-4-11-20(16)28/h1-4,6-7,10-11,17-18H,5,8-9,12-14,27-28H2,(H,29,33,35)(H,30,34,36)/t17-,18-/m1/s1 |
| InChIKey | MAZGYIBRFYOZFC-QZTJIDSGSA-N |
| XLogP | 4.36 |
| TPSA | 161.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.70 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|