C30H34N6O2S2 — CID 118444073
2-(4-ethylphenyl)-N-[5-[(1S,3S)-3-[5-[[2-(4-ethylphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 118444073) has the molecular formula C30H34N6O2S2 and a molecular weight of 574.78 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-N-[5-[(1S,3S)-3-[5-[[2-(4-ethylphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(4-ethylphenyl)-N-[5-[(1S,3S)-3-[5-[[2-(4-ethylphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 118444073 |
| Molecular Formula | C30H34N6O2S2 |
| Molecular Weight | 574.78 g/mol |
| Exact Mass | 574.22 |
| IUPAC Name | 2-(4-ethylphenyl)-N-[5-[(1S,3S)-3-[5-[[2-(4-ethylphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CCc1ccc(CC(=O)Nc2nnc([C@H]3CCC[C@H](c4nnc(NC(=O)Cc5ccc(CC)cc5)s4)C3)s2)cc1 |
| InChI | InChI=1S/C30H34N6O2S2/c1-3-19-8-12-21(13-9-19)16-25(37)31-29-35-33-27(39-29)23-6-5-7-24(18-23)28-34-36-30(40-28)32-26(38)17-22-14-10-20(4-2)11-15-22/h8-15,23-24H,3-7,16-18H2,1-2H3,(H,31,35,37)(H,32,36,38)/t23-,24-/m0/s1 |
| InChIKey | QQMWXFFQWXHJKW-ZEQRLZLVSA-N |
| XLogP | 6.32 |
| TPSA | 109.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.78 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |