C28H27N7O2S2 — CID 157247322
N-[5-[(1R,3R)-3-[5-[[2-(4-isocyanophenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]-2-(4-methylphenyl)acetamide (PubChem CID 157247322) has the molecular formula C28H27N7O2S2 and a molecular weight of 557.71 g/mol. Its IUPAC name is N-[5-[(1R,3R)-3-[5-[[2-(4-isocyanophenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]-2-(4-methylphenyl)acetamide.
| Compound Name | N-[5-[(1R,3R)-3-[5-[[2-(4-isocyanophenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 157247322 |
| Molecular Formula | C28H27N7O2S2 |
| Molecular Weight | 557.71 g/mol |
| Exact Mass | 557.17 |
| IUPAC Name | N-[5-[(1R,3R)-3-[5-[[2-(4-isocyanophenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]-2-(4-methylphenyl)acetamide |
| SMILES | [C-]#[N+]c1ccc(CC(=O)Nc2nnc([C@@H]3CCC[C@@H](c4nnc(NC(=O)Cc5ccc(C)cc5)s4)C3)s2)cc1 |
| InChI | InChI=1S/C28H27N7O2S2/c1-17-6-8-18(9-7-17)14-23(36)30-27-34-32-25(38-27)20-4-3-5-21(16-20)26-33-35-28(39-26)31-24(37)15-19-10-12-22(29-2)13-11-19/h6-13,20-21H,3-5,14-16H2,1H3,(H,30,34,36)(H,31,35,37)/t20-,21-/m1/s1 |
| InChIKey | TXELVHXYSCESMN-NHCUHLMSSA-N |
| XLogP | 6.05 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.71 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|