C27H29N7O2S2 — CID 118444061
2-(3-aminophenyl)-N-[5-[(1S,3S)-3-[5-[[2-(3-methylphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 118444061) has the molecular formula C27H29N7O2S2 and a molecular weight of 547.71 g/mol. Its IUPAC name is 2-(3-aminophenyl)-N-[5-[(1S,3S)-3-[5-[[2-(3-methylphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(3-aminophenyl)-N-[5-[(1S,3S)-3-[5-[[2-(3-methylphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 118444061 |
| Molecular Formula | C27H29N7O2S2 |
| Molecular Weight | 547.71 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | 2-(3-aminophenyl)-N-[5-[(1S,3S)-3-[5-[[2-(3-methylphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | Cc1cccc(CC(=O)Nc2nnc([C@H]3CCC[C@H](c4nnc(NC(=O)Cc5cccc(N)c5)s4)C3)s2)c1 |
| InChI | InChI=1S/C27H29N7O2S2/c1-16-5-2-6-17(11-16)13-22(35)29-26-33-31-24(37-26)19-8-4-9-20(15-19)25-32-34-27(38-25)30-23(36)14-18-7-3-10-21(28)12-18/h2-3,5-7,10-12,19-20H,4,8-9,13-15,28H2,1H3,(H,29,33,35)(H,30,34,36)/t19-,20-/m0/s1 |
| InChIKey | DJLJLNPNYXHCDY-PMACEKPBSA-N |
| XLogP | 5.08 |
| TPSA | 135.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.71 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|