C21H24N6O3S2 — CID 86719123
N-[5-[(1S,3S)-3-(5-acetamido-1,3,4-thiadiazol-2-yl)cyclohexyl]-1,3,4-thiadiazol-2-yl]-2-(3-methoxyphenyl)acetamide (PubChem CID 86719123) has the molecular formula C21H24N6O3S2 and a molecular weight of 472.60 g/mol. Its IUPAC name is N-[5-[(1S,3S)-3-(5-acetamido-1,3,4-thiadiazol-2-yl)cyclohexyl]-1,3,4-thiadiazol-2-yl]-2-(3-methoxyphenyl)acetamide.
| Compound Name | N-[5-[(1S,3S)-3-(5-acetamido-1,3,4-thiadiazol-2-yl)cyclohexyl]-1,3,4-thiadiazol-2-yl]-2-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 86719123 |
| Molecular Formula | C21H24N6O3S2 |
| Molecular Weight | 472.60 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | N-[5-[(1S,3S)-3-(5-acetamido-1,3,4-thiadiazol-2-yl)cyclohexyl]-1,3,4-thiadiazol-2-yl]-2-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(CC(=O)Nc2nnc([C@H]3CCC[C@H](c4nnc(NC(C)=O)s4)C3)s2)c1 |
| InChI | InChI=1S/C21H24N6O3S2/c1-12(28)22-20-26-24-18(31-20)14-6-4-7-15(11-14)19-25-27-21(32-19)23-17(29)10-13-5-3-8-16(9-13)30-2/h3,5,8-9,14-15H,4,6-7,10-11H2,1-2H3,(H,22,26,28)(H,23,27,29)/t14-,15-/m0/s1 |
| InChIKey | SMUHLZIKUSKZID-GJZGRUSLSA-N |
| XLogP | 3.98 |
| TPSA | 118.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.60 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |