C27H25F3N6O3S2 — CID 162572561
2-phenyl-N-[5-[(3S)-3-[5-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 162572561) has the molecular formula C27H25F3N6O3S2 and a molecular weight of 602.66 g/mol. Its IUPAC name is 2-phenyl-N-[5-[(3S)-3-[5-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-phenyl-N-[5-[(3S)-3-[5-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 162572561 |
| Molecular Formula | C27H25F3N6O3S2 |
| Molecular Weight | 602.66 g/mol |
| Exact Mass | 602.14 |
| IUPAC Name | 2-phenyl-N-[5-[(3S)-3-[5-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | O=C(Cc1ccccc1)Nc1nnc(C2CCC[C@H](c3nnc(NC(=O)Cc4cccc(OC(F)(F)F)c4)s3)C2)s1 |
| InChI | InChI=1S/C27H25F3N6O3S2/c28-27(29,30)39-20-11-4-8-17(12-20)14-22(38)32-26-36-34-24(41-26)19-10-5-9-18(15-19)23-33-35-25(40-23)31-21(37)13-16-6-2-1-3-7-16/h1-4,6-8,11-12,18-19H,5,9-10,13-15H2,(H,31,35,37)(H,32,36,38)/t18?,19-/m0/s1 |
| InChIKey | CQLFTFOTSPRNKJ-GGYWPGCISA-N |
| XLogP | 6.09 |
| TPSA | 118.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.66 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |