C26H23F3N6O4S2 — CID 118435976
2-hydroxy-2-phenyl-N-[5-[(1S,3S)-3-[5-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclopentyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 118435976) has the molecular formula C26H23F3N6O4S2 and a molecular weight of 604.64 g/mol. Its IUPAC name is 2-hydroxy-2-phenyl-N-[5-[(1S,3S)-3-[5-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclopentyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-hydroxy-2-phenyl-N-[5-[(1S,3S)-3-[5-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclopentyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 118435976 |
| Molecular Formula | C26H23F3N6O4S2 |
| Molecular Weight | 604.64 g/mol |
| Exact Mass | 604.12 |
| IUPAC Name | 2-hydroxy-2-phenyl-N-[5-[(1S,3S)-3-[5-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclopentyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | O=C(Cc1cccc(OC(F)(F)F)c1)Nc1nnc([C@H]2CC[C@H](c3nnc(NC(=O)C(O)c4ccccc4)s3)C2)s1 |
| InChI | InChI=1S/C26H23F3N6O4S2/c27-26(28,29)39-18-8-4-5-14(11-18)12-19(36)30-24-34-32-22(40-24)16-9-10-17(13-16)23-33-35-25(41-23)31-21(38)20(37)15-6-2-1-3-7-15/h1-8,11,16-17,20,37H,9-10,12-13H2,(H,30,34,36)(H,31,35,38)/t16-,17-,20?/m0/s1 |
| InChIKey | YPSRCFKMABYZEG-NBJLRHFZSA-N |
| XLogP | 5.19 |
| TPSA | 139.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.64 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |