C27H23F3N8O3S2 — CID 123526969
N-[5-[3-[5-[[2-(6-cyano-2-pyridinyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]-2-[3-(trifluoromethoxy)phenyl]acetamide (PubChem CID 123526969) has the molecular formula C27H23F3N8O3S2 and a molecular weight of 628.66 g/mol. Its IUPAC name is N-[5-[3-[5-[[2-(6-cyano-2-pyridinyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]-2-[3-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | N-[5-[3-[5-[[2-(6-cyano-2-pyridinyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]-2-[3-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 123526969 |
| Molecular Formula | C27H23F3N8O3S2 |
| Molecular Weight | 628.66 g/mol |
| Exact Mass | 628.13 |
| IUPAC Name | N-[5-[3-[5-[[2-(6-cyano-2-pyridinyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]-2-[3-(trifluoromethoxy)phenyl]acetamide |
| SMILES | N#Cc1cccc(CC(=O)Nc2nnc(C3CCCC(c4nnc(NC(=O)Cc5cccc(OC(F)(F)F)c5)s4)C3)s2)n1 |
| InChI | InChI=1S/C27H23F3N8O3S2/c28-27(29,30)41-20-9-1-4-15(10-20)11-21(39)33-25-37-35-23(42-25)16-5-2-6-17(12-16)24-36-38-26(43-24)34-22(40)13-18-7-3-8-19(14-31)32-18/h1,3-4,7-10,16-17H,2,5-6,11-13H2,(H,33,37,39)(H,34,38,40) |
| InChIKey | CVKUPCNVGJYHOY-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 155.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.66 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |