C28H28N8O2S2 — CID 163930138
2-(3-cyanophenyl)-N-[5-[(1S,3S)-3-[5-[[2-[3-(methylamino)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 163930138) has the molecular formula C28H28N8O2S2 and a molecular weight of 572.72 g/mol. Its IUPAC name is 2-(3-cyanophenyl)-N-[5-[(1S,3S)-3-[5-[[2-[3-(methylamino)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(3-cyanophenyl)-N-[5-[(1S,3S)-3-[5-[[2-[3-(methylamino)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 163930138 |
| Molecular Formula | C28H28N8O2S2 |
| Molecular Weight | 572.72 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | 2-(3-cyanophenyl)-N-[5-[(1S,3S)-3-[5-[[2-[3-(methylamino)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CNc1cccc(CC(=O)Nc2nnc([C@H]3CCC[C@H](c4nnc(NC(=O)Cc5cccc(C#N)c5)s4)C3)s2)c1 |
| InChI | InChI=1S/C28H28N8O2S2/c1-30-22-10-3-6-18(12-22)14-24(38)32-28-36-34-26(40-28)21-9-4-8-20(15-21)25-33-35-27(39-25)31-23(37)13-17-5-2-7-19(11-17)16-29/h2-3,5-7,10-12,20-21,30H,4,8-9,13-15H2,1H3,(H,31,35,37)(H,32,36,38)/t20-,21-/m0/s1 |
| InChIKey | RHYWYAYNVWQWSS-SFTDATJTSA-N |
| XLogP | 5.11 |
| TPSA | 145.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.72 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |