C17H18N4OS — CID 144630686
2-(3-cyanophenyl)-N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 144630686) has the molecular formula C17H18N4OS and a molecular weight of 326.42 g/mol. Its IUPAC name is 2-(3-cyanophenyl)-N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-(3-cyanophenyl)-N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 144630686 |
| Molecular Formula | C17H18N4OS |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 2-(3-cyanophenyl)-N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | N#Cc1cccc(CC(=O)Nc2nnc(C3CCCCC3)s2)c1 |
| InChI | InChI=1S/C17H18N4OS/c18-11-13-6-4-5-12(9-13)10-15(22)19-17-21-20-16(23-17)14-7-2-1-3-8-14/h4-6,9,14H,1-3,7-8,10H2,(H,19,21,22) |
| InChIKey | QBNOPRVKQGAVTE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |