C14H16N4OS — CID 139460837
N-(5-cyclopentyl-1,3,4-thiadiazol-2-yl)-2-pyridin-3-ylacetamide (PubChem CID 139460837) has the molecular formula C14H16N4OS and a molecular weight of 288.38 g/mol. Its IUPAC name is N-(5-cyclopentyl-1,3,4-thiadiazol-2-yl)-2-pyridin-3-ylacetamide.
| Compound Name | N-(5-cyclopentyl-1,3,4-thiadiazol-2-yl)-2-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 139460837 |
| Molecular Formula | C14H16N4OS |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | N-(5-cyclopentyl-1,3,4-thiadiazol-2-yl)-2-pyridin-3-ylacetamide |
| SMILES | O=C(Cc1cccnc1)Nc1nnc(C2CCCC2)s1 |
| InChI | InChI=1S/C14H16N4OS/c19-12(8-10-4-3-7-15-9-10)16-14-18-17-13(20-14)11-5-1-2-6-11/h3-4,7,9,11H,1-2,5-6,8H2,(H,16,18,19) |
| InChIKey | AEYJISDCHGNIMZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |