C36H44N8O2S2 — CID 90163405
2-(3-piperidin-4-ylphenyl)-N-[5-[(1S,3S)-3-[5-[[2-(3-piperidin-4-ylphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 90163405) has the molecular formula C36H44N8O2S2 and a molecular weight of 684.94 g/mol. Its IUPAC name is 2-(3-piperidin-4-ylphenyl)-N-[5-[(1S,3S)-3-[5-[[2-(3-piperidin-4-ylphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(3-piperidin-4-ylphenyl)-N-[5-[(1S,3S)-3-[5-[[2-(3-piperidin-4-ylphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 90163405 |
| Molecular Formula | C36H44N8O2S2 |
| Molecular Weight | 684.94 g/mol |
| Exact Mass | 684.30 |
| IUPAC Name | 2-(3-piperidin-4-ylphenyl)-N-[5-[(1S,3S)-3-[5-[[2-(3-piperidin-4-ylphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | O=C(Cc1cccc(C2CCNCC2)c1)Nc1nnc([C@H]2CCC[C@H](c3nnc(NC(=O)Cc4cccc(C5CCNCC5)c4)s3)C2)s1 |
| InChI | InChI=1S/C36H44N8O2S2/c45-31(20-23-4-1-6-27(18-23)25-10-14-37-15-11-25)39-35-43-41-33(47-35)29-8-3-9-30(22-29)34-42-44-36(48-34)40-32(46)21-24-5-2-7-28(19-24)26-12-16-38-17-13-26/h1-2,4-7,18-19,25-26,29-30,37-38H,3,8-17,20-22H2,(H,39,43,45)(H,40,44,46)/t29-,30-/m0/s1 |
| InChIKey | YSPGEHCCMDIBLC-KYJUHHDHSA-N |
| XLogP | 6.13 |
| TPSA | 133.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.94 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |