C27H27F3N6O4S — CID 123442643
2-hydroxy-N-[5-[4-[6-[[1-hydroxy-2-[3-(trifluoromethoxy)phenyl]ethyl]amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide (PubChem CID 123442643) has the molecular formula C27H27F3N6O4S and a molecular weight of 588.61 g/mol. Its IUPAC name is 2-hydroxy-N-[5-[4-[6-[[1-hydroxy-2-[3-(trifluoromethoxy)phenyl]ethyl]amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide.
| Compound Name | 2-hydroxy-N-[5-[4-[6-[[1-hydroxy-2-[3-(trifluoromethoxy)phenyl]ethyl]amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 123442643 |
| Molecular Formula | C27H27F3N6O4S |
| Molecular Weight | 588.61 g/mol |
| Exact Mass | 588.18 |
| IUPAC Name | 2-hydroxy-N-[5-[4-[6-[[1-hydroxy-2-[3-(trifluoromethoxy)phenyl]ethyl]amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide |
| SMILES | O=C(Nc1nnc(CCCCc2ccc(NC(O)Cc3cccc(OC(F)(F)F)c3)nn2)s1)C(O)c1ccccc1 |
| InChI | InChI=1S/C27H27F3N6O4S/c28-27(29,30)40-20-11-6-7-17(15-20)16-22(37)31-21-14-13-19(33-34-21)10-4-5-12-23-35-36-26(41-23)32-25(39)24(38)18-8-2-1-3-9-18/h1-3,6-9,11,13-15,22,24,37-38H,4-5,10,12,16H2,(H,31,34)(H,32,36,39) |
| InChIKey | IMZMKXBJLOMIIK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 142.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.61 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|