C26H28N6O3S2 — CID 74982605
(2S)-2-hydroxy-2-phenyl-N-[5-[4-[6-[(2-phenylacetyl)amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]acetamide;sulfane (PubChem CID 74982605) has the molecular formula C26H28N6O3S2 and a molecular weight of 536.68 g/mol. Its IUPAC name is (2S)-2-hydroxy-2-phenyl-N-[5-[4-[6-[(2-phenylacetyl)amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]acetamide;sulfane.
| Compound Name | (2S)-2-hydroxy-2-phenyl-N-[5-[4-[6-[(2-phenylacetyl)amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]acetamide;sulfane |
|---|---|
| PubChem CID | 74982605 |
| Molecular Formula | C26H28N6O3S2 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | (2S)-2-hydroxy-2-phenyl-N-[5-[4-[6-[(2-phenylacetyl)amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]acetamide;sulfane |
| SMILES | O=C(Cc1ccccc1)Nc1ccc(CCCCc2nnc(NC(=O)[C@@H](O)c3ccccc3)s2)nn1.S |
| InChI | InChI=1S/C26H26N6O3S.H2S/c33-22(17-18-9-3-1-4-10-18)27-21-16-15-20(29-30-21)13-7-8-14-23-31-32-26(36-23)28-25(35)24(34)19-11-5-2-6-12-19;/h1-6,9-12,15-16,24,34H,7-8,13-14,17H2,(H,27,30,33)(H,28,32,35);1H2/t24-;/m0./s1 |
| InChIKey | LGSAVWPOLVZGSB-JIDHJSLPSA-N |
| XLogP | 3.86 |
| TPSA | 129.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|