C27H25F3N6O2S — CID 74982757
2-phenyl-N-[6-[4-[5-[[2-[3-(trifluoromethyl)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]pyridazin-3-yl]acetamide (PubChem CID 74982757) has the molecular formula C27H25F3N6O2S and a molecular weight of 554.60 g/mol. Its IUPAC name is 2-phenyl-N-[6-[4-[5-[[2-[3-(trifluoromethyl)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]pyridazin-3-yl]acetamide.
| Compound Name | 2-phenyl-N-[6-[4-[5-[[2-[3-(trifluoromethyl)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]pyridazin-3-yl]acetamide |
|---|---|
| PubChem CID | 74982757 |
| Molecular Formula | C27H25F3N6O2S |
| Molecular Weight | 554.60 g/mol |
| Exact Mass | 554.17 |
| IUPAC Name | 2-phenyl-N-[6-[4-[5-[[2-[3-(trifluoromethyl)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]pyridazin-3-yl]acetamide |
| SMILES | O=C(Cc1ccccc1)Nc1ccc(CCCCc2nnc(NC(=O)Cc3cccc(C(F)(F)F)c3)s2)nn1 |
| InChI | InChI=1S/C27H25F3N6O2S/c28-27(29,30)20-10-6-9-19(15-20)17-24(38)32-26-36-35-25(39-26)12-5-4-11-21-13-14-22(34-33-21)31-23(37)16-18-7-2-1-3-8-18/h1-3,6-10,13-15H,4-5,11-12,16-17H2,(H,31,34,37)(H,32,36,38) |
| InChIKey | UBLQBIJOWRKDQD-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 109.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.60 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|